CAS 4731-88-8
:3,3′,5-Triiodothyronamine
Description:
3,3′,5-Triiodothyronamine (often abbreviated as TRIAC) is a chemical compound that is a derivative of thyronine, specifically related to thyroid hormones. It is characterized by the presence of three iodine atoms attached to the aromatic rings of the molecule, which significantly influences its biological activity. TRIAC is known for its role in modulating metabolic processes and has been studied for its potential effects on energy metabolism and thermogenesis. The compound exhibits a high affinity for thyroid hormone receptors, which allows it to exert physiological effects similar to those of thyroid hormones, albeit with distinct mechanisms. TRIAC is soluble in organic solvents and has limited solubility in water, which affects its bioavailability and pharmacokinetics. Its chemical structure includes an amine group, contributing to its reactivity and interactions with biological systems. Research into TRIAC continues to explore its therapeutic potential, particularly in conditions related to thyroid function and metabolic disorders.
Formula:C14H12I3NO2
InChI:InChI=1S/C14H12I3NO2/c15-10-7-9(1-2-13(10)19)20-14-11(16)5-8(3-4-18)6-12(14)17/h1-2,5-7,19H,3-4,18H2
InChI key:InChIKey=KIXGKGGCXPSNDX-UHFFFAOYSA-N
SMILES:O(C1=C(I)C=C(CCN)C=C1I)C2=CC(I)=C(O)C=C2
Synonyms:- Phenol, 4-[4-(2-aminoethyl)-2,6-diiodophenoxy]-2-iodo-
- 3,5,3′-Triiodothyronamine
- Thyronamine, 3,3′,5-triiodo-
- Triam
- 4-[4-(2-Aminoethyl)-2,6-diiodophenoxy]-2-iodophenol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Decarboxyl Liothyronine (4-[4-(2-Aminoethyl)-2,6-diiodophenoxy]-2-iodophenol)
CAS:Amino-naphthols and other amino-phenols, their ethers and esters, other than those cont more than one kind of oxygen function; salts thereof, nesoiFormula:C14H12I3NO2Color and Shape:Off-White PowderMolecular weight:606.80022
