CAS 473257-61-3
:Ethyl 5-chloro-4-fluoro-1H-indole-2-carboxylate
Description:
Ethyl 5-chloro-4-fluoro-1H-indole-2-carboxylate is a chemical compound characterized by its indole structure, which is a bicyclic compound consisting of a benzene ring fused to a pyrrole ring. This specific compound features a chloro and a fluoro substituent at the 5 and 4 positions, respectively, which can influence its reactivity and biological activity. The presence of the ethyl ester group at the 2-position contributes to its solubility and potential applications in organic synthesis and medicinal chemistry. The compound is likely to exhibit interesting pharmacological properties due to the indole core, which is known for its presence in various natural products and pharmaceuticals. Its molecular structure suggests potential interactions with biological targets, making it a candidate for further research in drug development. As with many halogenated compounds, it may also exhibit unique physical and chemical properties, such as altered boiling and melting points compared to its non-halogenated counterparts. Safety and handling precautions should be observed due to the presence of halogens, which can pose health risks.
Formula:C11H9ClFNO2
InChI:InChI=1S/C11H9ClFNO2/c1-2-16-11(15)9-5-6-8(14-9)4-3-7(12)10(6)13/h3-5,14H,2H2,1H3
InChI key:InChIKey=WQINJRZUYBEIPG-UHFFFAOYSA-N
SMILES:FC1=C2C(NC(C(OCC)=O)=C2)=CC=C1Cl
Synonyms:- Ethyl 5-chloro-4-fluoro-1H-indole-2-carboxylate
- 1H-Indole-2-carboxylic acid, 5-chloro-4-fluoro-, ethyl ester
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
ETHYL 5-CHLORO-4-FLUORO-1H-INDOLE-2-CARBOXYLATE
CAS:Formula:C11H9ClFNO2Purity:97.0%Molecular weight:241.65Ethyl 5-Chloro-4-fluoro-1H-indole-2-carboxylate
CAS:Ethyl 5-Chloro-4-fluoro-1H-indole-2-carboxylate is a potent inhibitor used in research chemicals. It has various applications, including the inhibition of diprenorphine, an opioid receptor antagonist. This compound can also be used as an electrode material due to its unique properties. Additionally, Ethyl 5-Chloro-4-fluoro-1H-indole-2-carboxylate has been studied for its potential effects on ginseng and aluminum metabolism. Furthermore, it has shown to have an impact on glutamate and fatty acid metabolism. This compound is also known for its role in reducing nitrous oxide emissions and inhibiting N-acetyltransferase activity. Overall, Ethyl 5-Chloro-4-fluoro-1H-indole-2-carboxylate is a versatile compound with diverse applications in various fields of research.Formula:C11H9NO2FClPurity:Min. 95%Molecular weight:241.64 g/mol


