CAS 4733-69-1

Furo[3,4-b]pyridin-7(5H)-one

Description:

Furo[3,4-b]pyridin-7(5H)-one, identified by its CAS number 4733-69-1, is a heterocyclic organic compound characterized by a fused ring system that includes both a furan and a pyridine moiety. This compound typically exhibits a bicyclic structure, which contributes to its unique chemical properties. It is known for its potential biological activities, including antimicrobial and anti-inflammatory effects, making it of interest in medicinal chemistry. The presence of the carbonyl group in the pyridinone structure enhances its reactivity, allowing for various chemical modifications. Furo[3,4-b]pyridin-7(5H)-one is generally soluble in organic solvents, and its stability can be influenced by environmental factors such as pH and temperature. The compound's synthesis often involves cyclization reactions, and it may serve as a precursor for the development of more complex pharmaceuticals. Overall, its distinctive structure and biological relevance make it a subject of interest in both synthetic and medicinal chemistry research.

Formula: C₇H₅NO₂

InChI: InChI=1S/C7H5NO2/c9-7-6-5(4-10-7)2-1-3-8-6/h1-3H,4H2

InChI key: InChIKey=VIHJMAPRLIOYER-UHFFFAOYSA-N

SMILES: O=C1C=2C(=CC=CN2)CO1

Synonyms:

• 7-Azaphthalide
• Picolinic acid, 3-(hydroxymethyl)-, γ-lactone
• Furo[3,4-b]pyridin-7(5H)-one

5H,7H-Furo[3,4-b]pyridin-7-one

CAS: 4733-69-1

5H,7H-Furo[3,4-b]pyridin-7-one is a compound that can be synthesized from anhydride and halogen. It can be prepared from cycloalkyl and chlorinating alkoxy by formulas. The high yield of this compd, which is hydrolyzed to the chloride, can be selectively chlorinated with dicarboxylic alkali. 5H,7H-Furo[3,4-b]pyridin-7-one is used as a precursor for synthesis of aralkyl.

Formula: C₇H₅NO₂

Purity: Min. 95%

Molecular weight: 135.12 g/mol

Ref: 3D-EAA73369