CAS 4733-73-7
:1,2,6-trimethylpiperidine
Description:
1,2,6-Trimethylpiperidine is a cyclic organic compound characterized by its piperidine ring, which is a six-membered nitrogen-containing heterocycle. The molecule features three methyl groups attached to the piperidine ring at the 1, 2, and 6 positions, contributing to its unique properties. It is a colorless to pale yellow liquid with a distinctive amine-like odor. This compound is known for its relatively high boiling point and moderate solubility in water, while being more soluble in organic solvents. 1,2,6-Trimethylpiperidine exhibits basic properties due to the presence of the nitrogen atom, making it a potential nucleophile in various chemical reactions. It is often utilized as a building block in organic synthesis and can serve as a ligand in coordination chemistry. Additionally, it has applications in the production of pharmaceuticals and agrochemicals. Safety considerations include handling it in well-ventilated areas and using appropriate personal protective equipment, as it may cause irritation upon contact with skin or eyes.
Formula:C8H17N
InChI:InChI=1/C8H17N/c1-7-5-4-6-8(2)9(7)3/h7-8H,4-6H2,1-3H3
Synonyms:- 1,2,6-TRIMETHYLPIPERIDINE
- Piperidine, 1,2,6-trimethyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.