CAS 4736-71-4

pyrrolidine-1-carboxamide

Description:

Pyrrolidine-1-carboxamide, with the CAS number 4736-71-4, is a cyclic amide derived from pyrrolidine, featuring a carboxamide functional group. This compound is characterized by its five-membered ring structure, which includes four carbon atoms and one nitrogen atom, contributing to its unique chemical properties. Pyrrolidine-1-carboxamide is typically a colorless to pale yellow solid or liquid, depending on its purity and specific form. It is soluble in polar solvents such as water and alcohols, which is indicative of its ability to engage in hydrogen bonding due to the presence of the amide group. The compound may exhibit biological activity, making it of interest in medicinal chemistry and pharmacology. Its stability under standard conditions allows for various synthetic applications, including the formation of derivatives that can be explored for therapeutic uses. As with many amides, it may participate in reactions typical of carbonyl compounds, such as hydrolysis or condensation, under appropriate conditions.

Formula: C₅H₁₀N₂O

InChI: InChI=1/C5H10N2O/c6-5(8)7-3-1-2-4-7/h1-4H2,(H2,6,8)

SMILES: C1CCN(C1)C(=N)O

Synonyms:

• 1-Pyrrolidinecarboxamide
• Pyrrolidine-1-carboxylic acid amide

Pyrrolidine-1-carboxylic acid amide

CAS: 4736-71-4

Formula: C₅H₁₀N₂O

Purity: 95%

Color and Shape: Solid

Molecular weight: 114.1457

Ref: IN-DA00DIG0

Pyrrolidine-1-carboxamide

CAS: 4736-71-4

Pyrrolidine-1-carboxamide

Purity: ≥95%

Molecular weight: 114.15g/mol

Ref: 54-OR302521

Pyrrolidine-1-carboxamide

CAS: 4736-71-4

Formula: C₅H₁₀N₂O

Purity: 95%

Molecular weight: 114.148

Ref: 10-F462444

Pyrrolidine-1-carboxamide

CAS: 4736-71-4

Pyrrolidine-1-carboxamide is a secondary metabolite that has been shown to have antimicrobial properties. This compound inhibits the growth of bacteria by binding to the 50S ribosomal subunit and prevents the formation of an antibiotic-inhibitor complex with the enzyme cell wall synthesis, inhibiting protein synthesis and cell division. Pyrrolidine-1-carboxamide has been shown to have antiinflammatory properties, which may be due to its inhibition of prostaglandin synthesis.

Formula: C₅H₁₀N₂O

Purity: Min. 95%

Molecular weight: 114.15 g/mol

Ref: 3D-EAA73671