CAS 4737-27-3

2,3-Dihydro-3-phenyl-4H-1-benzopyran-4-one

Description:

2,3-Dihydro-3-phenyl-4H-1-benzopyran-4-one, also known as a flavonoid derivative, is characterized by its fused benzopyran structure, which consists of a benzene ring fused to a pyran ring. This compound typically exhibits a pale yellow to light brown color and is soluble in organic solvents such as ethanol and acetone, but has limited solubility in water. It possesses a phenyl group that contributes to its aromatic properties and may influence its biological activity. The compound is known for its potential antioxidant and anti-inflammatory properties, making it of interest in pharmacological research. Its molecular structure allows for various interactions with biological systems, which can lead to diverse applications in medicinal chemistry. Additionally, it may undergo various chemical reactions, such as oxidation or reduction, depending on the conditions, which can modify its properties and reactivity. Overall, 2,3-Dihydro-3-phenyl-4H-1-benzopyran-4-one represents a significant class of compounds with potential therapeutic benefits.

Formula: C₁₅H₁₂O₂

InChI: InChI=1S/C15H12O2/c16-15-12-8-4-5-9-14(12)17-10-13(15)11-6-2-1-3-7-11/h1-9,13H,10H2

InChI key: InChIKey=RTRZOHKLISMNRD-UHFFFAOYSA-N

SMILES: O=C1C(COC=2C1=CC=CC2)C3=CC=CC=C3

Synonyms:

• 2,3-Dihydro-3-phenyl-4H-1-benzopyran-4-one
• 3-Phenyl-4-chromanone
• 3-Phenylchroman-4-One
• 4H-1-Benzopyran-4-one, 2,3-dihydro-3-phenyl-
• Isoflavan-4-one
• Isoflavanone
• iso-Flavanone