CymitQuimica logo

CAS 4737-49-9

:

2,2-diethyloxetane

Description:
2,2-Diethyloxetane is a cyclic ether characterized by its four-membered ring structure, which includes two ethyl groups attached to the second carbon atom of the oxetane ring. This compound is colorless and has a distinctive odor, typical of many organic solvents. It is known for its relatively low boiling point and moderate solubility in organic solvents, making it useful in various chemical applications. The presence of the oxetane ring imparts unique reactivity, allowing it to participate in ring-opening reactions, which can be exploited in polymer chemistry and synthesis. Additionally, 2,2-diethyloxetane may exhibit properties such as flammability and potential toxicity, necessitating careful handling and storage. Its applications can range from serving as a solvent to being a precursor in the synthesis of more complex organic molecules. As with many chemical substances, safety data sheets should be consulted for specific handling and exposure guidelines.
Formula:C7H14O
InChI:InChI=1/C7H14O/c1-3-7(4-2)5-6-8-7/h3-6H2,1-2H3
SMILES:CCC1(CC)CCO1
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.