CAS 473731-23-6
:3-Amino-2-hydroxy-N-(2-hydroxyethyl)benzamide
Description:
3-Amino-2-hydroxy-N-(2-hydroxyethyl)benzamide is an organic compound characterized by its amine and hydroxyl functional groups, which contribute to its solubility and reactivity. The presence of the amino group (-NH2) indicates potential basicity and the ability to form hydrogen bonds, while the hydroxyl groups (-OH) enhance its polarity and solubility in water. This compound features a benzamide structure, which typically exhibits moderate stability and can participate in various chemical reactions, including acylation and amidation. The ethyl group attached to the nitrogen atom introduces additional steric factors that may influence its reactivity and interactions with other molecules. Due to its functional groups, this compound may exhibit biological activity, making it of interest in pharmaceutical and biochemical research. Its specific properties, such as melting point, boiling point, and spectral characteristics, would depend on the molecular environment and conditions under which it is studied. Overall, 3-Amino-2-hydroxy-N-(2-hydroxyethyl)benzamide is a versatile compound with potential applications in various fields, including medicinal chemistry and materials science.
Formula:C9H12N2O3
InChI:InChI=1S/C9H12N2O3/c10-7-3-1-2-6(8(7)13)9(14)11-4-5-12/h1-3,12-13H,4-5,10H2,(H,11,14)
InChI key:InChIKey=VOSFUGQVFHPXCE-UHFFFAOYSA-N
SMILES:C(NCCO)(=O)C1=C(O)C(N)=CC=C1
Synonyms:- Benzamide, 3-amino-2-hydroxy-N-(2-hydroxyethyl)-
- 3-Amino-2-hydroxy-N-(2-hydroxyethyl)benzamide
- N-(2-Hydroxyethyl)-3-amino-2-hydroxybenzamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
