
CAS 473732-82-0
:α-(1,1-Dimethylethyl)-2-thiophenemethanamine
Description:
α-(1,1-Dimethylethyl)-2-thiophenemethanamine, identified by its CAS number 473732-82-0, is a chemical compound characterized by the presence of a thiophene ring and an amine functional group. This compound features a branched alkyl group, specifically a tert-butyl group, which contributes to its steric properties and may influence its reactivity and solubility. The thiophene moiety introduces aromatic characteristics, potentially affecting the compound's electronic properties and interactions with other molecules. As an amine, it can participate in hydrogen bonding and may exhibit basicity, which can be relevant in various chemical reactions and applications. The presence of both the thiophene and amine functionalities suggests potential uses in pharmaceuticals, agrochemicals, or as intermediates in organic synthesis. However, specific physical properties such as melting point, boiling point, and solubility would need to be referenced from experimental data or literature for detailed applications and handling guidelines.
Formula:C9H15NS
InChI:InChI=1S/C9H15NS/c1-9(2,3)8(10)7-5-4-6-11-7/h4-6,8H,10H2,1-3H3
InChI key:InChIKey=VIDGALYHKGLIBL-UHFFFAOYSA-N
SMILES:C(C(C)(C)C)(N)C1=CC=CS1
Synonyms:- (2,2-Dimethyl-1-(thien-2-yl)propyl)amine
- 2-(1-Amino-2,2-dimethylpropyl)thiophene
- α-(1,1-Dimethylethyl)-2-thiophenemethanamine
- 2-Thiophenemethanamine, α-(1,1-dimethylethyl)-
- 2,2-Dimethyl-1-(thiophen-2-yl)propan-1-amine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.