CAS 473737-34-7

Phenylmethyl 4-bromo-1,2-dihydrospiro[3H-indole-3,4′-piperidine]-1′-carboxylate

Description:

Phenylmethyl 4-bromo-1,2-dihydrospiro[3H-indole-3,4′-piperidine]-1′-carboxylate is a complex organic compound characterized by its unique spirocyclic structure, which incorporates both indole and piperidine moieties. The presence of a bromine atom at the 4-position of the molecule contributes to its reactivity and potential biological activity. This compound features a carboxylate functional group, which can influence its solubility and interaction with biological systems. The phenylmethyl group enhances its lipophilicity, potentially affecting its pharmacokinetic properties. As a result of its structural features, this compound may exhibit interesting pharmacological properties, making it a subject of interest in medicinal chemistry. Its synthesis and characterization typically involve multi-step organic reactions, and it may be utilized in research related to drug development or as a chemical probe in biological studies. However, specific applications and biological activities would require further investigation through empirical studies.

Formula: C₂₀H₂₁BrN₂O₂

InChI: InChI=1S/C20H21BrN2O2/c21-16-7-4-8-17-18(16)20(14-22-17)9-11-23(12-10-20)19(24)25-13-15-5-2-1-3-6-15/h1-8,22H,9-14H2

InChI key: InChIKey=HDOGWWUPVQLVCT-UHFFFAOYSA-N

SMILES: BrC1=C2C3(CNC2=CC=C1)CCN(C(OCC4=CC=CC=C4)=O)CC3

Synonyms:

• Phenylmethyl 4-bromo-1,2-dihydrospiro[3H-indole-3,4′-piperidine]-1′-carboxylate
• Spiro[3H-indole-3,4′-piperidine]-1′-carboxylic acid, 4-bromo-1,2-dihydro-, phenylmethyl ester

benzyl 4-bromospiro[1,2-dihydroindole-3,4'-piperidine]-1'-carboxylate

CAS: 473737-34-7

Formula: C₂₀H₂₁BrN₂O₂

Purity: 96%

Molecular weight: 401.2969

Ref: IN-DA00I8MY

Benzyl 4-bromo-1,2-dihydrospiro[indole-3,4'-piperidine]-1'-carboxylate

CAS: 473737-34-7

Purity: 95+%

Molecular weight: 401.3039855957031

Ref: 10-F601815