CAS 473838-38-9

N,3,3-Trimethyl-1-(phenylmethyl)-4-piperidinamine

Description:

N,3,3-Trimethyl-1-(phenylmethyl)-4-piperidinamine, identified by its CAS number 473838-38-9, is a chemical compound characterized by its piperidine structure, which includes a piperidine ring substituted with a phenylmethyl group and three methyl groups at the nitrogen atom. This compound is typically classified as an amine due to the presence of the amine functional group. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, owing to its ability to interact with biological systems. The presence of the phenylmethyl group may enhance lipophilicity, potentially influencing its pharmacokinetic properties. Additionally, the trimethyl substitution can affect the compound's steric and electronic properties, which may be relevant for its biological activity. As with many amines, it may exhibit basicity and can participate in various chemical reactions, including alkylation and acylation. Safety and handling precautions should be observed, as with all chemical substances, due to potential toxicity and reactivity.

Formula: C₁₅H₂₄N₂

InChI: InChI=1S/C15H24N2/c1-15(2)12-17(10-9-14(15)16-3)11-13-7-5-4-6-8-13/h4-8,14,16H,9-12H2,1-3H3

InChI key: InChIKey=CTHAKBRIQNCWOJ-UHFFFAOYSA-N

SMILES: C(N1CC(C)(C)C(NC)CC1)C2=CC=CC=C2

Synonyms:

• N,3,3-Trimethyl-1-(phenylmethyl)-4-piperidinamine
• 1-Benzyl-N,3,3-trimethylpiperidin-4-amine
• 1-Benzyl-4-methylamino-3,3-dimethylpiperidine
• 4-Piperidinamine, N,3,3-trimethyl-1-(phenylmethyl)-