CAS 473895-87-3
:Ethyl 6-quinoxalineacetate
Description:
Ethyl 6-quinoxalineacetate is an organic compound characterized by its quinoxaline structure, which is a bicyclic compound containing two nitrogen atoms in the aromatic ring. This substance typically appears as a solid or liquid, depending on its purity and specific conditions. It is known for its potential applications in medicinal chemistry, particularly in the development of pharmaceuticals due to its ability to interact with biological targets. The presence of the ethyl ester group contributes to its solubility in organic solvents, making it useful in various chemical reactions and synthesis processes. Ethyl 6-quinoxalineacetate may exhibit biological activities, including antimicrobial or anticancer properties, although specific activities can vary based on structural modifications and the presence of substituents. As with many organic compounds, safety precautions should be taken when handling it, as it may pose health risks if ingested or inhaled. Overall, this compound represents a valuable entity in the field of organic synthesis and drug discovery.
Formula:C12H12N2O2
InChI:InChI=1S/C12H12N2O2/c1-2-16-12(15)8-9-3-4-10-11(7-9)14-6-5-13-10/h3-7H,2,8H2,1H3
InChI key:InChIKey=XQDDZGLTYPDZOI-UHFFFAOYSA-N
SMILES:C(C(OCC)=O)C1=CC2=C(C=C1)N=CC=N2
Synonyms:- Ethyl 6-quinoxalineacetate
- 6-Quinoxalineacetic acid, ethyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.