
CAS 473895-89-5
:Quinoxaline, 6-(2-chloroethyl)-
Description:
Quinoxaline, 6-(2-chloroethyl)- is a chemical compound characterized by its quinoxaline core, which is a bicyclic structure containing two nitrogen atoms in the rings. This compound features a chloroethyl group at the 6-position, which contributes to its reactivity and potential applications in medicinal chemistry. Quinoxalines are known for their diverse biological activities, including antimicrobial and anticancer properties. The presence of the chloroethyl substituent may enhance its ability to interact with biological targets, making it a subject of interest in drug development. Additionally, the compound's molecular structure suggests it may participate in nucleophilic substitution reactions due to the electrophilic nature of the chloroethyl group. Its physical properties, such as solubility and melting point, can vary based on the specific conditions and purity of the sample. Overall, Quinoxaline, 6-(2-chloroethyl)- represents a valuable compound in the field of organic chemistry and pharmacology, warranting further investigation for its potential therapeutic applications.
Formula:C10H9ClN2
InChI:InChI=1S/C10H9ClN2/c11-4-3-8-1-2-9-10(7-8)13-6-5-12-9/h1-2,5-7H,3-4H2
InChI key:InChIKey=GCWODTJPOQIOAG-UHFFFAOYSA-N
SMILES:C(CCl)C1=CC2=C(C=C1)N=CC=N2
Synonyms:- Quinoxaline, 6-(2-chloroethyl)-
- 6-(2-Chloroethyl)quinoxaline
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.