CAS 473927-51-4
:3-Hydrazinylbenzamide
Description:
3-Hydrazinylbenzamide is an organic compound characterized by the presence of a hydrazine functional group (-NH-NH2) attached to a benzamide structure. This compound typically exhibits properties associated with both hydrazines and amides, including potential reactivity due to the hydrazine moiety, which can participate in various chemical reactions such as oxidation and condensation. The benzamide portion contributes to its stability and solubility in polar solvents. 3-Hydrazinylbenzamide may also exhibit biological activity, making it of interest in medicinal chemistry and drug development. Its molecular structure allows for potential interactions with biological targets, which could lead to applications in pharmaceuticals. Additionally, the compound's characteristics, such as melting point, boiling point, and solubility, can vary based on the specific conditions and purity of the sample. As with many hydrazine derivatives, safety precautions should be taken when handling this compound due to its potential toxicity and reactivity.
Formula:C7H9N3O
InChI:InChI=1S/C7H9N3O/c8-7(11)5-2-1-3-6(4-5)10-9/h1-4,10H,9H2,(H2,8,11)
InChI key:InChIKey=VFIRVGATLQLDMV-UHFFFAOYSA-N
SMILES:C(N)(=O)C1=CC(NN)=CC=C1
Synonyms:- 3-(Hydrazino)benzamide
- 3-Hydrazinylbenzamide
- Benzamide, 3-hydrazino-
- Benzamide, 3-hydrazinyl-
- 3-Carboxamidophenyl hydrazine
- Frovatriptan Impurity 5
- Benzamide, 3-hydrazino- (9CI)
- Frovatriptan 3-Hydrazinylbenzamide Impurity/ Frovatriptan Impurity 5
- Frovatriptan 3-Hydrazinylbenzamide Impurity
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
