CAS 474-63-5: 24-Methylenecholesterol
Description:24-Methylenecholesterol is a sterol, a type of organic compound that is a key component of cell membranes and serves as a precursor for various biological molecules. It is characterized by its complex structure, which includes a steroid nucleus with a hydroxyl group and a double bond in the side chain. This compound plays a significant role in the biosynthesis of sterols and is involved in the metabolic pathways of cholesterol. 24-Methylenecholesterol is primarily found in certain plants and fungi, where it contributes to membrane fluidity and stability. Its presence is also noted in some animal tissues, where it may influence cholesterol metabolism. The compound is of interest in biochemistry and pharmacology due to its potential effects on cholesterol levels and its role in the synthesis of other important sterols. Additionally, it may have implications in research related to cardiovascular health and metabolic disorders. Overall, 24-Methylenecholesterol is a significant sterol with diverse biological functions and potential applications in health sciences.
Formula:C28H46O
InChI:InChI=1S/C28H46O/c1-18(2)19(3)7-8-20(4)24-11-12-25-23-10-9-21-17-22(29)13-15-27(21,5)26(23)14-16-28(24,25)6/h9,18,20,22-26,29H,3,7-8,10-17H2,1-2,4-6H3/t20-,22+,23+,24-,25+,26+,27+,28-/m1/s1
InChI key:InChIKey=INDVLXYUCBVVKW-PXBBAZSNSA-N
SMILES:OC1CC2=CCC3C(CCC4(C)C(CCC34)C(C)CCC(=C)C(C)C)C2(C)CC1
- Synonyms:
- (3β)-Ergosta-5,24(28)-dien-3-ol
- 24-Methylcholesta-5,24(28)-dien-3β-ol
- 24-Methylenecholest-5-en-3β-ol
- 24-Methylenecholesterol
- Chalinasterol
- Cholesterol, 24-methylene-
- Ergosta-5,24(28)-Dien-3-Ol, (3Beta)-
- Ergosta-5,24(28)-dien-3-ol, (3.beta.)-
- Ergosta-5,24(28)-dien-3-ol, (3β)-
- Ergosta-5,24(28)-dien-3.beta.-ol
- See more synonyms
- Ergosta-5,24(28)-dien-3beta-ol (8CI)
- Ergosta-5,24(28)-dien-3β-ol
- NSC 232664
- Ostreasterol
