CAS 474-68-0
:Episterol
Description:
Episterol, with the CAS number 474-68-0, is a steroid compound that is structurally related to cholesterol. It is characterized by its specific arrangement of carbon, hydrogen, and oxygen atoms, which contributes to its biological activity. Episterol is typically found in various natural sources, including certain plants and fungi, and is known for its potential role in influencing cellular processes. The compound exhibits lipophilic properties, allowing it to interact with cell membranes and potentially modulate membrane fluidity and permeability. Additionally, Episterol may have implications in pharmacology and biochemistry, particularly in studies related to cholesterol metabolism and steroid hormone synthesis. Its unique structure allows it to participate in various biochemical pathways, making it a subject of interest in both research and potential therapeutic applications. However, detailed studies are necessary to fully understand its mechanisms of action and potential health benefits or risks.
Formula:C28H46O
InChI:InChI=1S/C28H46O/c1-18(2)19(3)7-8-20(4)24-11-12-25-23-10-9-21-17-22(29)13-15-27(21,5)26(23)14-16-28(24,25)6/h10,18,20-22,24-26,29H,3,7-9,11-17H2,1-2,4-6H3/t20-,21+,22+,24-,25+,26+,27+,28-/m1/s1
InChI key:InChIKey=BTCAEOLDEYPGGE-JVAZTMFWSA-N
SMILES:C[C@@]12[C@](C=3[C@@]([C@]4(C)[C@@](CC3)(C[C@@H](O)CC4)[H])(CC1)[H])(CC[C@@]2([C@@H](CCC(C(C)C)=C)C)[H])[H]
Synonyms:- (3β,5α)-Ergosta-7,24(28)-dien-3-ol
- 24-Methyl-5α-cholesta-7,24(28)-dien-3β-ol
- 24-Methylene-5α-cholest-7-en-3β-ol
- 24-Methylenecholesta-7,24(28)-dien-3β-ol
- 5α-Ergosta-7,24(28)-dien-3β-ol
- Episterin
- Episterol
- Ergosta-7,24(28)-Dien-3-Ol, (3Beta,5Alpha)-
- Ergosta-7,24(28)-dien-3-ol, (3β,5α)-
- Δ<sup>7,24(28)</sup>-Ergostadienol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Episterol
CAS:<p>Applications Episterol is a compound influencing ergosterol biosynthesis, and thus acting as an antifungal agent.<br>References Mallory, J. et al.: Pharmacol., 3, 179 (2012); Mueller, C. et al.: Steroids, 78, 483 (2013);<br></p>Formula:C28H46OColor and Shape:NeatMolecular weight:398.66
