CAS 474024-36-7
:2-Bromo-4-(trifluoromethyl)phenylacetonitrile
Description:
2-Bromo-4-(trifluoromethyl)phenylacetonitrile is an organic compound characterized by its unique structure, which includes a bromine atom and a trifluoromethyl group attached to a phenyl ring, along with an acetonitrile functional group. This compound typically appears as a colorless to pale yellow solid or liquid, depending on its purity and form. It is known for its relatively high stability under standard conditions, although it may be sensitive to moisture and light. The presence of the bromine and trifluoromethyl groups contributes to its reactivity, making it useful in various chemical syntheses, particularly in the development of pharmaceuticals and agrochemicals. Its molecular structure allows for potential interactions in nucleophilic substitution reactions. Additionally, the compound's physical properties, such as melting point and boiling point, can vary based on the specific conditions and purity levels. Safety precautions should be observed when handling this compound, as it may pose health risks if ingested or inhaled.
Formula:C9H5BrF3N
InChI:InChI=1/C9H5BrF3N/c10-8-5-7(9(11,12)13)2-1-6(8)3-4-14/h1-2,5H,3H2
SMILES:c1cc(cc(c1CC#N)Br)C(F)(F)F
Synonyms:- [2-Bromo-4-(trifluoromethyl)phenyl]acetonitrile
- Benzeneacetonitrile, 2-Bromo-4-(Trifluoromethyl)-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
2-Bromo-4-(trifluoromethyl)phenylacetonitrile, 98%
CAS:<p>2-Bromo-4-(trifluoromethyl)phenylacetonitrile is used as pharmaceutical intermediate. This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item</p>Formula:C9H5BrF3NPurity:98%Molecular weight:264.042-Bromo-4-(trifluoromethyl)phenylacetonitrile
CAS:Formula:C9H5BrF3NPurity:98%Color and Shape:LiquidMolecular weight:264.04192-Bromo-4-(trifluoromethyl)phenylacetonitrile
CAS:2-Bromo-4-(trifluoromethyl)phenylacetonitrileFormula:C9H5BrF3NPurity:≥95%Color and Shape: clear.colourless liquidMolecular weight:264.04g/mol2-Bromo-4-(trifluoromethyl)phenylacetonitrile
CAS:Formula:C9H5BrF3NPurity:98%Color and Shape:LiquidMolecular weight:264.045



