CAS 474310-74-2

(1Z)-2-pyridin-3-ylethanimidamide

Description:

(1Z)-2-pyridin-3-ylethanimidamide, with the CAS number 474310-74-2, is a chemical compound characterized by its unique structural features. It contains a pyridine ring, which is a six-membered aromatic ring with one nitrogen atom, contributing to its basicity and potential for forming hydrogen bonds. The compound features an ethanimidamide functional group, which includes an amine and an imine, indicating its potential reactivity in various chemical reactions, particularly in the formation of amides and other nitrogen-containing compounds. The presence of the pyridine moiety may enhance its solubility in polar solvents and influence its biological activity, making it of interest in medicinal chemistry. Additionally, the (1Z) configuration suggests a specific geometric arrangement around the double bond, which can affect the compound's reactivity and interaction with biological targets. Overall, (1Z)-2-pyridin-3-ylethanimidamide is notable for its potential applications in pharmaceuticals and its role in various chemical synthesis processes.

Formula: C₇H₉N₃

InChI: InChI=1/C7H9N3/c8-7(9)4-6-2-1-3-10-5-6/h1-3,5H,4H2,(H3,8,9)

SMILES: c1cc(CC(=N)N)cnc1

Synonyms:

• 3-Pyridineethanimidamide