CAS 4744-53-0
:1,2,3,4-Tetrahydropyrazino[1,2-a]benzimidazole
Description:
1,2,3,4-Tetrahydropyrazino[1,2-a]benzimidazole is a bicyclic compound that features a fused pyrazine and benzimidazole structure. This compound is characterized by its nitrogen-containing heterocyclic framework, which contributes to its potential biological activity. It typically appears as a solid at room temperature and may exhibit moderate solubility in organic solvents. The presence of multiple nitrogen atoms in its structure can influence its reactivity and interaction with biological systems, making it of interest in medicinal chemistry. The compound may also display various functional properties, such as potential pharmacological effects, which are often explored in drug development. Its CAS number, 4744-53-0, allows for easy identification in chemical databases. As with many heterocycles, the specific characteristics, including melting point, boiling point, and spectral data, can vary based on the purity and specific conditions under which the compound is synthesized or stored. Overall, 1,2,3,4-Tetrahydropyrazino[1,2-a]benzimidazole represents a unique structure with potential applications in various fields, including pharmaceuticals.
Formula:C10H11N3
InChI:InChI=1S/C10H11N3/c1-2-4-9-8(3-1)12-10-7-11-5-6-13(9)10/h1-4,11H,5-7H2
InChI key:InChIKey=CVGPZQMGLKRVJV-UHFFFAOYSA-N
SMILES:C1=2N3C(=NC1=CC=CC2)CNCC3
Synonyms:- 1,2,3,4-Tetrahydropyrazino[1,2-a]benzimidazole
- 1,2,3,4-Tetrahydrobenzo[4,5]imidazo[1,2-a]pyrazine
- Pyrazino[1,2-a]benzimidazole, 1,2,3,4-tetrahydro-
- NSC 700996
- 1,2,3,4-TETRAHYDRO-PYRAZINO[1,2-A]BENZIMIDAZOLE
- Pyrazino[1,2-a]benzimidazole, 1,2,3,4-tetrahydro- (6CI,8CI,9CI)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.