CAS 474432-61-6

Pyrazolo[1,5-a]pyridine-6-carboxylic acid

Description:

Pyrazolo[1,5-a]pyridine-6-carboxylic acid is a heterocyclic organic compound characterized by its fused pyrazole and pyridine rings, which contribute to its unique chemical properties. This compound typically exhibits a carboxylic acid functional group at the 6-position of the pyridine ring, influencing its acidity and reactivity. It is known for its potential biological activities, making it of interest in medicinal chemistry and drug development. The presence of both nitrogen atoms in the ring structure can enhance its ability to form hydrogen bonds, which is significant for interactions with biological targets. Additionally, the compound may exhibit moderate solubility in polar solvents due to the carboxylic acid group, while its aromatic nature can contribute to stability and lipophilicity. Overall, Pyrazolo[1,5-a]pyridine-6-carboxylic acid serves as a valuable scaffold in the synthesis of various derivatives, which may possess diverse pharmacological properties.

Formula: C₈H₆N₂O₂

InChI: InChI=1S/C8H6N2O2/c11-8(12)6-1-2-7-3-4-9-10(7)5-6/h1-5H,(H,11,12)

InChI key: InChIKey=SXVVFWMAODMGBM-UHFFFAOYSA-N

SMILES: C(O)(=O)C1=CN2C(C=C1)=CC=N2

Synonyms:

• Pyrazolo[1,5-a]pyridine-6-carboxylic acid

Pyrazolo[1,5-a]pyridine-6-carboxylic acid

CAS: 474432-61-6

Formula: C₈H₆N₂O₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 162.1454

Ref: IN-DA003ASE

Pyrazolo[1,5-a]pyridine-6-carboxylic acid

CAS: 474432-61-6

Pyrazolo[1,5-a]pyridine-6-carboxylic acid

Purity: 98%

Molecular weight: 162.15g/mol

Ref: 54-OR1035965

Pyrazolo[1,5-a]pyridine-6-carboxylic acid

CAS: 474432-61-6

Purity: 98%

Molecular weight: 162.147995

Ref: 10-F619364