CAS 474534-37-7

[2-(methoxymethoxy)phenyl]-(2-pyridyl)methanone

Description:

[2-(Methoxymethoxy)phenyl]-(2-pyridyl)methanone, with the CAS number 474534-37-7, is an organic compound characterized by its complex structure that includes a phenyl group substituted with a methoxymethoxy group and a pyridyl group attached to a carbonyl moiety. This compound typically exhibits properties associated with both aromatic and heterocyclic systems, which can influence its reactivity and interactions. The presence of the methoxymethoxy group suggests potential for hydrogen bonding and increased solubility in organic solvents, while the pyridyl moiety may contribute to its basicity and ability to participate in coordination chemistry. The carbonyl functional group is indicative of ketones, which are known for their reactivity in nucleophilic addition reactions. Overall, this compound may exhibit interesting biological activities and could be of interest in medicinal chemistry or material science, depending on its specific applications and interactions with biological systems or other chemical entities.

Formula: C₁₄H₁₃NO₃

InChI: InChI=1/C14H13NO3/c1-17-10-18-13-8-3-2-6-11(13)14(16)12-7-4-5-9-15-12/h2-9H,10H2,1H3

SMILES: COCOc1ccccc1C(=O)c1ccccn1

[2-(methoxymethoxy)phenyl](pyridin-2-yl)methanone

CAS: 474534-37-7

Formula: C₁₄H₁₃NO₃

Purity: 95.0%

Molecular weight: 243.262

Ref: 10-F308010