CAS 474534-39-9

[4-(Methoxymethoxy)phenyl]-2-pyridinylmethanone

Description:

[4-(Methoxymethoxy)phenyl]-2-pyridinylmethanone, identified by its CAS number 474534-39-9, is an organic compound characterized by its complex structure, which includes a phenyl ring substituted with a methoxymethoxy group and a pyridinylmethanone moiety. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, such as stability and potential reactivity due to the presence of functional groups. The methoxymethoxy substituent can influence its solubility and polarity, making it more soluble in organic solvents. Additionally, the pyridinyl group may impart basicity and can participate in various chemical reactions, including nucleophilic substitutions. The compound may also exhibit biological activity, making it of interest in medicinal chemistry and drug development. Its synthesis and characterization would involve standard organic chemistry techniques, including spectroscopic methods for confirmation of structure. Overall, this compound represents a unique combination of functional groups that can lead to diverse applications in research and industry.

Formula: C₁₄H₁₃NO₃

InChI: InChI=1S/C14H13NO3/c1-17-10-18-12-7-5-11(6-8-12)14(16)13-4-2-3-9-15-13/h2-9H,10H2,1H3

InChI key: InChIKey=JYSUVVIQPSJOLQ-UHFFFAOYSA-N

SMILES: C(=O)(C1=CC=C(OCOC)C=C1)C2=CC=CC=N2

Synonyms:

• Methanone, [4-(methoxymethoxy)phenyl]-2-pyridinyl-
• [4-(Methoxymethoxy)phenyl]-2-pyridinylmethanone

[4-(methoxymethoxy)phenyl](pyridin-2-yl)methanone

CAS: 474534-39-9

Formula: C₁₄H₁₃NO₃

Purity: 95.0%

Molecular weight: 243.262

Ref: 10-F308012