CAS 474534-40-2

[2-(Methoxymethoxy)phenyl]-3-pyridinylmethanone

Description:

[2-(Methoxymethoxy)phenyl]-3-pyridinylmethanone, identified by its CAS number 474534-40-2, is a chemical compound that features a complex structure comprising a phenyl ring substituted with methoxymethoxy groups and a pyridinylmethanone moiety. This compound is characterized by its potential applications in medicinal chemistry, particularly in the development of pharmaceuticals due to its unique functional groups that may interact with biological targets. The presence of the methoxy groups enhances its solubility and may influence its pharmacokinetic properties. Additionally, the pyridine ring contributes to its aromatic character and may participate in various chemical reactions, such as nucleophilic substitutions or coordination with metal ions. The compound's molecular structure suggests it may exhibit interesting biological activities, making it a subject of interest for further research in drug discovery and development. As with many organic compounds, its stability, reactivity, and interactions with other substances would depend on environmental conditions such as pH, temperature, and solvent.

Formula: C₁₄H₁₃NO₃

InChI: InChI=1S/C14H13NO3/c1-17-10-18-13-7-3-2-6-12(13)14(16)11-5-4-8-15-9-11/h2-9H,10H2,1H3

InChI key: InChIKey=PGDCMZBPSVKHPG-UHFFFAOYSA-N

SMILES: C(=O)(C1=C(OCOC)C=CC=C1)C=2C=CC=NC2

Synonyms:

• Methanone, [2-(methoxymethoxy)phenyl]-3-pyridinyl-
• [2-(Methoxymethoxy)phenyl]-3-pyridinylmethanone

[2-(methoxymethoxy)phenyl](pyridin-3-yl)methanone

CAS: 474534-40-2

Formula: C₁₄H₁₃NO₃

Purity: 95.0%

Molecular weight: 243.262

Ref: 10-F308013