CymitQuimica logo

CAS 474554-57-9

:

1-[5-Bromo-3-(dimethylamino)-2-methoxyphenyl]ethanone

Description:
1-[5-Bromo-3-(dimethylamino)-2-methoxyphenyl]ethanone, with the CAS number 474554-57-9, is an organic compound characterized by its complex structure, which includes a bromine atom, a dimethylamino group, and a methoxy group attached to a phenyl ring. This compound typically exhibits properties associated with aromatic ketones, including potential reactivity in electrophilic substitution reactions due to the presence of the electron-donating dimethylamino group and the electron-withdrawing bromine atom. The methoxy group can influence the compound's solubility and polarity, making it more soluble in organic solvents. Additionally, the presence of the bromine atom may impart unique biological activities, making this compound of interest in medicinal chemistry and drug development. Its molecular structure suggests potential applications in various fields, including pharmaceuticals and agrochemicals, although specific biological activities and applications would require further investigation. Overall, this compound exemplifies the diverse functionalities that can arise from modifications to aromatic systems.
Formula:C11H14BrNO2
InChI:InChI=1S/C11H14BrNO2/c1-7(14)9-5-8(12)6-10(13(2)3)11(9)15-4/h5-6H,1-4H3
InChI key:InChIKey=XSFUVPIBNIWGMR-UHFFFAOYSA-N
SMILES:O(C)C1=C(C(C)=O)C=C(Br)C=C1N(C)C
Synonyms:
  • 1-[5-Bromo-3-(dimethylamino)-2-methoxyphenyl]ethanone
  • Ethanone, 1-[5-bromo-3-(dimethylamino)-2-methoxyphenyl]-
  • 1-[5-Bromo-3-(dimethylamino)-2-methoxyphenyl]-1-ethanone
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.