CAS 4746-17-2
:2-(hydroxymethyl)-6-{[(5Z)-1,2,4-trihydroxy-5,6-bis(2-phenylhydrazinylidene)hexan-3-yl]oxy}tetrahydro-2H-pyran-3,4,5-triol (non-preferred name)
Description:
The chemical substance known as 2-(hydroxymethyl)-6-{[(5Z)-1,2,4-trihydroxy-5,6-bis(2-phenylhydrazinylidene)hexan-3-yl]oxy}tetrahydro-2H-pyran-3,4,5-triol, with the CAS number 4746-17-2, is a complex organic compound characterized by its multi-functional groups and stereochemistry. It features a tetrahydropyran ring, which contributes to its cyclic structure, and multiple hydroxyl (-OH) groups that enhance its solubility in polar solvents and may impart biological activity. The presence of phenylhydrazine moieties suggests potential reactivity, particularly in forming hydrazones or engaging in redox reactions. This compound may exhibit properties such as antioxidant activity or potential use in medicinal chemistry due to its structural complexity. Its synthesis and applications could be of interest in fields like pharmaceuticals or materials science, where such multifunctional compounds are valuable. However, specific biological activities, stability, and reactivity would require further investigation through empirical studies.
Formula:C24H32N4O9
InChI:InChI=1/C24H32N4O9/c29-12-17(31)23(37-24-22(35)21(34)20(33)18(13-30)36-24)19(32)16(28-27-15-9-5-2-6-10-15)11-25-26-14-7-3-1-4-8-14/h1-11,17-24,26-27,29-35H,12-13H2/b25-11u,28-16-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
Lactosazone
CAS:Controlled Product<p>Applications Lactosazone is an intermediate in the synthesis of Hydralazine Lactosone Ring-opened Adduct (H675150). Hydralazine Lactosone Ring-opened Adduct is a derivative of Lactose (L114000).<br></p>Formula:C24H32N4O9Color and Shape:NeatMolecular weight:520.53Lactosazone
CAS:<p>Lactosazone is an anticancer compound that is found in human urine and has been synthesized as an analog of Chinese medicinal polysaccharides. It has been shown to inhibit the activity of cancer cell kinases, which are enzymes involved in tumor growth and proliferation. Lactosazone acts as a protein inhibitor, inducing apoptosis in cancer cells by disrupting their normal cellular processes. This compound has shown promising results in preclinical studies as a potential treatment for various types of cancer. Its ability to selectively target cancer cells while sparing healthy cells makes it a promising candidate for further development as a therapeutic agent.</p>Formula:C24H32N4O9Purity:Min. 95%Molecular weight:520.5 g/mol

