CAS 4746-93-4

1,4-dioxaspiro[4.5]decane-6-carboxylic acid

Description:

1,4-Dioxaspiro[4.5]decane-6-carboxylic acid is a bicyclic organic compound characterized by its unique spiro structure, which consists of a dioxane ring fused to a decane framework. This compound features two ether oxygen atoms within the dioxane moiety and a carboxylic acid functional group, which contributes to its acidity and potential reactivity. The presence of the carboxylic acid group allows for hydrogen bonding, influencing its solubility and interaction with other molecules. The spiro configuration imparts rigidity to the molecular structure, which can affect its physical properties, such as boiling and melting points. Additionally, the compound may exhibit interesting biological activities due to its structural features, making it a subject of interest in medicinal chemistry. Its CAS number, 4746-93-4, serves as a unique identifier for regulatory and research purposes. Overall, 1,4-dioxaspiro[4.5]decane-6-carboxylic acid is notable for its distinctive architecture and potential applications in various chemical and pharmaceutical contexts.

Formula: C₉H₁₄O₄

InChI: InChI=1/C9H14O4/c10-8(11)7-3-1-2-4-9(7)12-5-6-13-9/h7H,1-6H2,(H,10,11)

SMILES: C1CCC2(C(C1)C(=O)O)OCCO2