CAS 4747-46-0

1-phenyl-1H-pyrazole-3-carboxylic acid

Description:

1-Phenyl-1H-pyrazole-3-carboxylic acid is an organic compound characterized by its pyrazole ring, which is a five-membered heterocyclic structure containing two nitrogen atoms. This compound features a phenyl group attached to the pyrazole ring, contributing to its aromatic properties. The carboxylic acid functional group (-COOH) at the 3-position of the pyrazole ring imparts acidic characteristics, making it capable of donating protons in solution. This compound is typically a white to off-white solid and is soluble in polar solvents like water and alcohols, while being less soluble in non-polar solvents. Its structure allows for potential applications in pharmaceuticals and agrochemicals, as derivatives of pyrazole compounds often exhibit biological activity. Additionally, the presence of both the phenyl and carboxylic acid groups can influence its reactivity and interaction with other chemical species, making it a subject of interest in synthetic organic chemistry and medicinal chemistry research.

Formula: C₁₀H₈N₂O₂

InChI: InChI=1/C10H8N2O2/c13-10(14)9-6-7-12(11-9)8-4-2-1-3-5-8/h1-7H,(H,13,14)

SMILES: c1ccc(cc1)n1ccc(C(=O)O)n1

Synonyms:

• 1-Phenyl-3-pyrazolecarboxylic acid
• 4747-46-0
• 1-phenylpyrazole-3-carboxylic acid
• 1-phenyl-1H-pyrazole-3-carboxylic acid
• 1H-Pyrazole-3-carboxylic acid, 1-phenyl-

1-phenyl-1H-pyrazole-3-carboxylic acid

CAS: 4747-46-0

Formula: C₁₀H₈N₂O₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 188.1827

Ref: IN-DA00DHXH

1-Phenyl-1H-pyrazole-3-carboxylic acid

CAS: 4747-46-0

1-Phenyl-1H-pyrazole-3-carboxylic acid

Purity: 95%

Ref: 54-OR1038256

1-PHENYL-1H-PYRAZOLE-3-CARBOXYLIC ACID

CAS: 4747-46-0

Purity: 95%

Molecular weight: 188.1860046

Ref: 10-F803784

1-Phenyl-1H-pyrazole-3-carboxylic acid

CAS: 4747-46-0

1-Phenyl-1H-pyrazole-3-carboxylic acid is an organic compound that has a pyrazole ring. It can be synthesized by the reaction of phenylhydrazine and formamide. The amido group in the molecule is bound to the carbonyl carbon atom, which makes it a carboxylic acid. This compound is also known as a morpholine amido ester. One example of this type of compound is 1-(4-Methoxyphenyl)-1H-pyrazole-3-carboxylic acid. The analogous compound in this series is 2-(2,6-dimethylphenyl)-1H-pyrrole-3-carboxylic acid.

Formula: C₁₀H₈N₂O₂

Purity: Min. 95%

Molecular weight: 188.18 g/mol

Ref: 3D-EAA74746