CymitQuimica logo

CAS 474711-03-0

:

Piperazine, 1-(3-cyclopropylphenyl)-

Description:
Piperazine, 1-(3-cyclopropylphenyl)-, identified by CAS number 474711-03-0, is a chemical compound that belongs to the piperazine class, which is characterized by a six-membered ring containing two nitrogen atoms at opposite positions. This specific compound features a cyclopropylphenyl group attached to the piperazine ring, which can influence its biological activity and chemical properties. Typically, piperazine derivatives are known for their potential pharmacological applications, including anti-anxiety, antidepressant, and antipsychotic effects. The presence of the cyclopropyl group may enhance the lipophilicity and receptor binding affinity of the molecule, making it of interest in medicinal chemistry. Additionally, the compound's solubility, stability, and reactivity can be influenced by the substituents on the piperazine ring and the cyclopropylphenyl moiety. As with many piperazine derivatives, further studies are often required to fully understand its biological activity, safety profile, and potential therapeutic uses.
Formula:C13H18N2
InChI:InChI=1S/C13H18N2/c1-2-12(11-4-5-11)10-13(3-1)15-8-6-14-7-9-15/h1-3,10-11,14H,4-9H2
InChI key:InChIKey=VFAWNLROPUAKAC-UHFFFAOYSA-N
SMILES:C1(=CC(=CC=C1)N2CCNCC2)C3CC3
Synonyms:
  • Piperazine, 1-(3-cyclopropylphenyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.