CymitQuimica logo

CAS 474824-78-7

:

3-Bromo-5-methylpicolinonitrile

Description:
3-Bromo-5-methylpicolinonitrile is a chemical compound characterized by its unique structure, which includes a bromine atom, a methyl group, and a nitrile functional group attached to a pyridine ring. This compound is part of the picolinonitrile family, which are derivatives of pyridine with a cyano group. It typically appears as a solid at room temperature and is soluble in organic solvents. The presence of the bromine atom introduces notable reactivity, making it useful in various synthetic applications, including medicinal chemistry and material science. The nitrile group contributes to its potential as a building block in organic synthesis, allowing for further functionalization. Additionally, the compound may exhibit biological activity, which can be explored in pharmaceutical research. Safety data should be consulted for handling, as halogenated compounds can pose health risks. Overall, 3-Bromo-5-methylpicolinonitrile is a versatile compound with applications in both research and industry.
Formula:C7H5BrN2
InChI:InChI=1S/C7H5BrN2/c1-5-2-6(8)7(3-9)10-4-5/h2,4H,1H3
InChI key:WGKYSFRFMQHMOF-UHFFFAOYSA-N
SMILES:CC1=CC(=C(N=C1)C#N)Br
Found 4 products.