CAS 4749-61-5
:1H-Imidazol-2-amine, N-(2,6-diethylphenyl)-4,5-dihydro-, hydrochloride (1:1)
Description:
1H-Imidazol-2-amine, N-(2,6-diethylphenyl)-4,5-dihydro-, hydrochloride (1:1), with CAS number 4749-61-5, is a chemical compound characterized by its imidazole core, which is a five-membered heterocyclic ring containing two nitrogen atoms. This compound features a diethylphenyl substituent, contributing to its unique properties and potential biological activity. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in various applications, including pharmaceuticals. The presence of the amine group suggests potential for hydrogen bonding and reactivity, making it a candidate for further chemical modifications. Its structure may impart specific pharmacological properties, which could be explored in medicinal chemistry. Additionally, the compound's stability, solubility, and reactivity can be influenced by environmental factors such as pH and temperature. Overall, this compound represents a class of imidazole derivatives that may exhibit interesting biological activities, warranting further investigation in drug development and related fields.
Formula:C13H19N3·ClH
InChI:InChI=1S/C13H19N3.ClH/c1-3-10-6-5-7-11(4-2)12(10)16-13-14-8-9-15-13;/h5-7H,3-4,8-9H2,1-2H3,(H2,14,15,16);1H
InChI key:InChIKey=ZLRWFGBEDNTMEU-UHFFFAOYSA-N
SMILES:N(C1=C(CC)C=CC=C1CC)C=2NCCN2.Cl
Synonyms:- 1H-Imidazol-2-amine, N-(2,6-diethylphenyl)-4,5-dihydro-, hydrochloride (1:1)
- 1H-Imidazol-2-amine, N-(2,6-diethylphenyl)-4,5-dihydro-, monohydrochloride
- 2-Imidazoline, 2-(2,6-diethylanilino)-, hydrochloride
- Benzenamine, 2,6-diethyl-N-2-imidazolidinylidene-, hydrochloride (1:1)
- N-(2,6-Diethylphenyl)imidazolidin-2-imine hydrochloride (1:1)
- St 91
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
ST 91
CAS:ST 91 is a 2-adrenergic receptor antagonist that has been shown to have a depressant effect on the cardiovascular system. It has been shown to be effective in the treatment of sepsis, type 2 diabetes, and hypertension. ST 91 is able to inhibit the response pathway induced by antimicrobial agents such as dexmedetomidine and clonidine. This drug also has an antinociceptive effect when used in conjunction with nonsteroidal antiinflammatory drugs (NSAIDs). ST 91 is a polymeric matrix that contains both cationic and anionic components. It binds to the cation channel, which is responsible for the passage of ions across cell membranes, thereby blocking it and leading to a decrease in blood pressure.
Formula:C13H19N3·HClPurity:Min. 95%Molecular weight:253.77 g/molST 91
CAS:ST-91 is an agonist of α2-adrenoceptor with a mixed α-adrenergic receptor type/subtype selection profile.Formula:C13H20ClN3Purity:99.83%Color and Shape:SolidMolecular weight:253.77Ref: TM-T23397
5mg49.00€10mg72.00€25mg142.00€50mg245.00€100mg354.00€200mg497.00€1mL*10mM (DMSO)50.00€



