CymitQuimica logo

CAS 474918-32-6

:

2-Bromo-9,9-diphenylfluorene

Description:
2-Bromo-9,9-diphenylfluorene is an organic compound characterized by its unique structure, which includes a fluorene backbone substituted with two phenyl groups and a bromine atom at the 2-position. This compound typically exhibits a high degree of stability due to the conjugated system of the fluorene structure, which can contribute to its electronic properties. It is often used in organic synthesis and materials science, particularly in the development of organic semiconductors and light-emitting devices. The presence of the bromine atom can enhance its reactivity, making it a useful intermediate in various chemical reactions, including cross-coupling reactions. Additionally, 2-bromo-9,9-diphenylfluorene may display interesting photophysical properties, such as fluorescence, which can be exploited in optoelectronic applications. Its solubility and stability in organic solvents make it suitable for various laboratory applications. As with many brominated compounds, it is important to handle it with care due to potential environmental and health impacts associated with bromine-containing substances.
Formula:C25H17Br
InChI:InChI=1/C25H17Br/c26-20-15-16-22-21-13-7-8-14-23(21)25(24(22)17-20,18-9-3-1-4-10-18)19-11-5-2-6-12-19/h1-17H
InChI key:WNXNWOBGPRKOJF-UHFFFAOYSA-N
SMILES:c1ccc(cc1)C1(c2ccccc2)c2ccccc2c2ccc(cc12)Br
Synonyms:
  • 2-bromo-9,9-diphenyl-9H-fluorene
  • 2-Bromo-9,5-diphenylfluorene
Found 5 products.