
CAS 474922-84-4
:Poly(oxy-1,2-ethanediyl), α-[(9R)-6-hydroxy-6-oxido-1,12-dioxo-9-[(1-oxohexadecyl)oxy]-5,7,11-trioxa-2-aza-6-phosphaheptacos-1-yl]-ω-methoxy-, ammonium salt
Description:
Poly(oxy-1,2-ethanediyl), α-[(9R)-6-hydroxy-6-oxido-1,12-dioxo-9-[(1-oxohexadecyl)oxy]-5,7,11-trioxa-2-aza-6-phosphaheptacos-1-yl]-ω-methoxy-, ammonium salt, identified by CAS number 474922-84-4, is a complex amphiphilic compound characterized by its polyether backbone and phosphonium functionality. This substance typically exhibits surfactant properties, making it useful in various applications, including drug delivery systems and as an emulsifying agent. The presence of both hydrophilic (poly(oxy-1,2-ethanediyl) and hydrophobic (long-chain alkyl) segments allows for the formation of micelles or vesicles in aqueous environments, enhancing solubility and bioavailability of hydrophobic drugs. Additionally, the phosphonium group contributes to its stability and interaction with biological membranes. Its unique structure may also impart specific biological activities, such as antimicrobial or antifouling properties, depending on the context of its use. Overall, this compound represents a versatile class of materials with potential applications in pharmaceuticals, biotechnology, and materials science.
Formula:(C2H4O)nC39H76NO10P·H3N
Synonyms:- Poly(oxy-1,2-ethanediyl), α-[(9R)-6-hydroxy-6-oxido-1,12-dioxo-9-[(1-oxohexadecyl)oxy]-5,7,11-trioxa-2-aza-6-phosphaheptacos-1-yl]-ω-methoxy-, ammonium salt
- DPPE-mPEG
- 1,2-Dipalmitoyl-sn-glycero-3-phosphoethanolamine-N-[methoxy(polyethylene glycol)] ammonium salt
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
DPPE-mPEG
CAS:<p>DPPE-mPEG, a PEG-modified lipid, minimizes nonspecific protein adsorption and extends circulation time in vivo [1].</p>Formula:(C2H4O)nC39H76NO10P·H3NColor and Shape:SolidMolecular weight:2700(Average)

