CAS 475058-41-4
:(S)-3-Hydroxypiperidine hydrochloride
Description:
(S)-3-Hydroxypiperidine hydrochloride is a chemical compound characterized by its piperidine ring structure, which is a six-membered saturated nitrogen-containing heterocycle. The "S" in its name indicates that it has a specific stereochemistry, making it an enantiomer of 3-hydroxypiperidine. This compound typically appears as a white to off-white crystalline solid and is soluble in water, which is a common trait for many hydrochloride salts. Its hydroxyl group (-OH) contributes to its potential reactivity and solubility properties. (S)-3-Hydroxypiperidine hydrochloride is of interest in medicinal chemistry, particularly for its potential applications in drug development, as it may serve as a building block for various pharmaceuticals. The hydrochloride form enhances its stability and bioavailability. As with many chemical substances, handling should be done with care, following appropriate safety protocols, as it may have specific health and environmental considerations.
Formula:C5H12ClNO
InChI:InChI=1/C5H11NO.ClH/c7-5-2-1-3-6-4-5;/h5-7H,1-4H2;1H/t5-;/m0./s1
SMILES:C1C[C@@H](CNC1)O.Cl
Synonyms:- (3S)-3-Piperidinol hydrochloride
- (3S)-Piperidin-3-ol hydrochloride (1:1)
- (3S)-Piperidin-3-olhydrochlorid
- (S)-3-Hydroxypiperidine HCl
- 3-Piperidinol, (3S)-, hydrochloride (1:1)
- (3S)-piperidin-3-ol hydrochloride
- S-3-Hydroxy Piperidine Hcl
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
(3S)-Piperidin-3-ol, HCl
CAS:Formula:C5H12ClNOPurity:98%Color and Shape:SolidMolecular weight:137.6079(3S)-(-)-3-Hydroxypiperidine hydrochloride
CAS:(3S)-(-)-3-Hydroxypiperidine hydrochlorideFormula:C5H11NO·ClHPurity:97%Color and Shape: pale yellow solidMolecular weight:137.61g/mol(S)-3-Hydroxypiperidine Hydrochloride
CAS:Formula:C5H11NO·HClPurity:>98.0%(T)Color and Shape:White to Almost white powder to crystalMolecular weight:137.61(S)-3-Hydroxypiperidine hydrochloride
CAS:Formula:C5H12ClNOPurity:96%Color and Shape:SolidMolecular weight:137.61(S)-3-Hydroxypiperidine hydrochloride
CAS:<p>3-Hydroxypiperidine hydrochloride is an industrial chemical that is used in the synthesis of medicines. It is a nucleophile, and will react with electrophiles in a nucleophilic substitution reaction. 3-Hydroxypiperidine hydrochloride can be used for the synthesis of sulfinates, which are often used as medicine reagents. 3-Hydroxypiperidine hydrochloride has also been shown to be useful in the synthesis of five-membered heterocycles, such as diazepinones, from 2-aminoethanethiols.</p>Formula:C5H12ClNOPurity:Min. 95%Color and Shape:White PowderMolecular weight:137.61 g/mol






