CymitQuimica logo

CAS 475102-17-1

:

1,1-Dimethylethyl 2-(dimethylsilyl)-5-methyl-1H-indole-1-carboxylate

Description:
1,1-Dimethylethyl 2-(dimethylsilyl)-5-methyl-1H-indole-1-carboxylate, identified by its CAS number 475102-17-1, is a chemical compound that belongs to the indole family, characterized by its complex structure featuring an indole ring system. This compound contains functional groups such as a carboxylate ester and a dimethylsilyl group, which contribute to its unique chemical properties. The presence of the tert-butyl group (1,1-dimethylethyl) enhances its steric bulk, potentially influencing its reactivity and solubility. The dimethylsilyl group can provide increased stability and hydrophobic characteristics, making the compound suitable for various applications in organic synthesis and materials science. Additionally, the methyl substituents on the indole ring may affect its electronic properties and biological activity. Overall, this compound's structural features suggest potential utility in medicinal chemistry and as a building block in the synthesis of more complex molecules. However, specific reactivity, stability, and biological activity would require further investigation through experimental studies.
Formula:C16H23NO2Si
InChI:InChI=1S/C16H23NO2Si/c1-11-7-8-13-12(9-11)10-14(20(5)6)17(13)15(18)19-16(2,3)4/h7-10,20H,1-6H3
InChI key:InChIKey=RIECPYZYOLVSJK-UHFFFAOYSA-N
SMILES:C(OC(C)(C)C)(=O)N1C=2C(C=C1[SiH](C)C)=CC(C)=CC2
Synonyms:
  • 1,1-Dimethylethyl 2-(dimethylsilyl)-5-methyl-1H-indole-1-carboxylate
  • 1-Boc-2-dimethylsilanyl-5-methyl-indole
  • 1H-Indole-1-carboxylic acid, 2-(dimethylsilyl)-5-methyl-, 1,1-dimethylethyl ester
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.