CAS 475105-36-3
:1,1-Dimethylethyl 2-[(2-benzoxazolylamino)methyl]-1-piperidinecarboxylate
Description:
1,1-Dimethylethyl 2-[(2-benzoxazolylamino)methyl]-1-piperidinecarboxylate, identified by its CAS number 475105-36-3, is a chemical compound that features a piperidine ring, which is a six-membered nitrogen-containing heterocycle. This compound is characterized by the presence of a dimethyl group, which contributes to its steric bulk, and a benzoxazole moiety that may impart specific biological activities or interactions. The carboxylate functional group suggests potential for forming salts or participating in various chemical reactions. The compound's structure indicates it may exhibit properties relevant to medicinal chemistry, particularly in the development of pharmaceuticals, due to the presence of the piperidine and benzoxazole components, which are often associated with bioactive compounds. Additionally, the presence of the amino group suggests potential for hydrogen bonding and interactions with biological targets. Overall, this compound's unique structural features may contribute to its chemical reactivity and potential applications in various fields, including drug development and materials science.
Formula:C18H25N3O3
InChI:InChI=1S/C18H25N3O3/c1-18(2,3)24-17(22)21-11-7-6-8-13(21)12-19-16-20-14-9-4-5-10-15(14)23-16/h4-5,9-10,13H,6-8,11-12H2,1-3H3,(H,19,20)
InChI key:InChIKey=NADCSOYLAAERSG-UHFFFAOYSA-N
SMILES:N(CC1N(C(OC(C)(C)C)=O)CCCC1)C2=NC=3C(O2)=CC=CC3
Synonyms:- 1-Piperidinecarboxylic acid, 2-[(2-benzoxazolylamino)methyl]-, 1,1-dimethylethyl ester
- 1,1-Dimethylethyl 2-[(2-benzoxazolylamino)methyl]-1-piperidinecarboxylate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.