CAS 475111-38-7: 4-(4-Chloro-6-(2-(difluoromethyl)-1H-benzo[d]imidazol-1-yl)-1,3,5-triazin-2-yl)morpholine
Description:4-(4-Chloro-6-(2-(difluoromethyl)-1H-benzo[d]imidazol-1-yl)-1,3,5-triazin-2-yl)morpholine, with CAS number 475111-38-7, is a synthetic organic compound characterized by its complex molecular structure, which includes a morpholine ring, a triazine moiety, and a benzoimidazole unit. This compound features a chloro substituent and a difluoromethyl group, contributing to its unique chemical properties. It is typically classified as a heterocyclic compound due to the presence of nitrogen atoms in its rings. The presence of multiple functional groups suggests potential applications in pharmaceuticals or agrochemicals, particularly as a bioactive agent. Its solubility and stability can vary based on environmental conditions, such as pH and temperature. Additionally, the compound's reactivity may be influenced by the electron-withdrawing effects of the chloro and difluoromethyl groups, which can affect its interaction with biological targets. Overall, this compound exemplifies the complexity and diversity of modern synthetic chemistry, with implications for various fields of research and application.
Formula:C15H13ClF2N6O
InChI:InChI=1/C15H13ClF2N6O/c16-13-20-14(23-5-7-25-8-6-23)22-15(21-13)24-10-4-2-1-3-9(10)19-12(24)11(17)18/h1-4,11H,5-8H2
- Synonyms:
- 1-[4-Chlor-6-(morpholin-4-yl)-1,3,5-triazin-2-yl]-2-(difluormethyl)-1H-benzimidazol
- 1-[4-Chloro-6-(4-morpholinyl)-1,3,5-triazin-2-yl]-2-(difluoromethyl)-1H-benzimidazole
- 1-[4-Chloro-6-(morpholin-4-yl)-1,3,5-triazin-2-yl]-2-(difluoromethyl)-1H-benzimidazole
- 1H-benzimidazole, 1-[4-chloro-6-(4-morpholinyl)-1,3,5-triazin-2-yl]-2-(difluoromethyl)-

4-(4-CHLORO-6-(2-(DIFLUOROMETHYL)-1H-BENZO[D]IMIDAZOL-1-YL)-1,3,5-TRIAZIN-2-YL)MORPHOLINE
Ref: IN-DA00DB2F
1g | 256.00 € | ||
100mg | 97.00 € | ||
250mg | 128.00 € |

4-(4-Chloro-6-(2-(difluoromethyl)-1H-benzo[d]imidazol-1-yl)-1,3,5-triazin-2-yl)morpholine
Ref: 54-PC101249
1g | 285.00 € | ||
5g | 1,216.00 € | ||
100mg | 72.00 € | ||
250mg | 111.00 € |

4-(4-Chloro-6-(2-(difluoromethyl)-1H-benzo[d]imidazol-1-yl)-1,3,5-triazin-2-yl)morpholine
Ref: 10-F216881
1g | 138.00 € | ||
5g | 597.00 € | ||
100mg | 35.00 € | ||
250mg | 51.00 € |

4-[4-chloro-6-[2-(difluoromethyl)benzimidazol-1-yl]-1,3,5-tr
Ref: 3D-FC106255
50mg | Discontinued | Request information | |
100mg | Discontinued | Request information | |
250mg | Discontinued | Request information |