CAS 475152-31-9

Spiro[furo[3,4-b]pyridine-5(7H),4′-piperidin]-7-one, hydrochloride (1:1)

Description:

Spiro[furo[3,4-b]pyridine-5(7H),4′-piperidin]-7-one, hydrochloride (1:1), identified by CAS number 475152-31-9, is a chemical compound characterized by its unique spirocyclic structure, which combines a furo[3,4-b]pyridine moiety with a piperidine ring. This compound typically exhibits properties associated with both heterocyclic and cyclic amine compounds, making it of interest in medicinal chemistry. The hydrochloride salt form enhances its solubility in water, which is beneficial for biological applications. The presence of the piperidine ring suggests potential interactions with biological targets, possibly influencing neurotransmitter systems. Its structural features may contribute to various pharmacological activities, although specific biological effects would depend on further empirical studies. As with many synthetic organic compounds, handling should be conducted with care, following appropriate safety protocols due to potential toxicity or reactivity. Overall, this compound represents a fascinating area of study for researchers interested in drug development and the synthesis of novel therapeutic agents.

Formula: C₁₁H₁₂N₂O₂·ClH

InChI: InChI=1S/C11H12N2O2.ClH/c14-10-9-8(2-1-5-13-9)11(15-10)3-6-12-7-4-11;/h1-2,5,12H,3-4,6-7H2;1H

InChI key: InChIKey=LECFLCMZSBVBPT-UHFFFAOYSA-N

SMILES: O=C1OC2(C=3C1=NC=CC3)CCNCC2.Cl

Synonyms:

• Spiro[furo[3,4-b]pyridine-5(7H),4′-piperidin]-7-one, hydrochloride (1:1)
• Spiro[furo[3,4-b]pyridine-5(7H),4′-piperidin]-7-one, monohydrochloride