CymitQuimica logo

CAS 475152-33-1

:

Spiro[furo[3,4-c]pyridine-1(3H),4′-piperidin]-3-one, hydrochloride (1:1)

Description:
Spiro[furo[3,4-c]pyridine-1(3H),4′-piperidin]-3-one, hydrochloride (1:1), identified by CAS number 475152-33-1, is a chemical compound characterized by its unique spirocyclic structure, which combines a furo-pyridine moiety with a piperidine ring. This compound typically exhibits a solid state at room temperature and is soluble in polar solvents, such as water and alcohols, due to the presence of the hydrochloride salt form. The spiro configuration contributes to its potential biological activity, making it of interest in medicinal chemistry for its possible pharmacological properties. The compound may exhibit various functional groups that can participate in chemical reactions, influencing its reactivity and interaction with biological targets. Its hydrochloride form enhances stability and solubility, which is advantageous for formulation in pharmaceutical applications. As with many heterocyclic compounds, it may possess diverse applications in drug discovery, particularly in the development of therapeutics targeting neurological or psychiatric conditions. Further studies would be necessary to elucidate its specific biological activities and mechanisms of action.
Formula:C11H12N2O2·ClH
InChI:InChI=1S/C11H12N2O2.ClH/c14-10-8-7-13-4-1-9(8)11(15-10)2-5-12-6-3-11;/h1,4,7,12H,2-3,5-6H2;1H
InChI key:InChIKey=DHROTJKPYYRNST-UHFFFAOYSA-N
SMILES:O=C1OC2(C=3C1=CN=CC3)CCNCC2.Cl
Synonyms:
  • Spiro[furo[3,4-c]pyridine-1(3H),4′-piperidin]-3-one, hydrochloride (1:1)
  • Spiro[furo[3,4-c]pyridine-1(3H),4′-piperidin]-3-one, monohydrochloride
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.