CymitQuimica logo

CAS 475161-97-8

:

benzyl 3,4,5-tribenzyloxybenzoate

Description:
Benzyl 3,4,5-tribenzyloxybenzoate is an organic compound characterized by its complex structure, which includes multiple benzyl and benzoate groups. This compound typically exhibits properties associated with aromatic compounds, such as stability and a tendency to engage in π-π stacking interactions. It is likely to be a white to off-white solid at room temperature, with low solubility in water but higher solubility in organic solvents like ethanol and dichloromethane. The presence of multiple benzyl groups suggests that it may have interesting electronic properties, potentially making it useful in applications such as organic synthesis, pharmaceuticals, or materials science. Additionally, the compound may exhibit moderate to high melting and boiling points due to its molecular weight and structural complexity. Its reactivity can be influenced by the functional groups present, allowing for various chemical transformations. As with many organic compounds, safety precautions should be taken when handling it, as it may pose health risks if ingested or inhaled.
Formula:C35H30O5
InChI:InChI=1/C35H30O5/c36-35(40-26-30-19-11-4-12-20-30)31-21-32(37-23-27-13-5-1-6-14-27)34(39-25-29-17-9-3-10-18-29)33(22-31)38-24-28-15-7-2-8-16-28/h1-22H,23-26H2
SMILES:c1ccc(cc1)COc1cc(cc(c1OCc1ccccc1)OCc1ccccc1)C(=O)OCc1ccccc1
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.