
CAS 475162-11-9
:2-[(2-Chlorophenyl)amino]-2-oxoethanimidic acid 2-phenylhydrazide
Description:
2-[(2-Chlorophenyl)amino]-2-oxoethanimidic acid 2-phenylhydrazide, with the CAS number 475162-11-9, is a chemical compound characterized by its complex structure, which includes an amine group, a hydrazide moiety, and a chlorophenyl substituent. This compound typically exhibits properties associated with both hydrazides and amides, such as potential reactivity towards electrophiles and nucleophiles. It may display moderate solubility in polar solvents due to the presence of functional groups that can engage in hydrogen bonding. The chlorophenyl group can influence the compound's electronic properties, potentially affecting its reactivity and biological activity. Additionally, compounds of this type may be of interest in medicinal chemistry for their potential pharmacological properties, including antimicrobial or anticancer activities. However, specific biological activities and safety profiles would require further investigation through empirical studies. As with many organic compounds, proper handling and safety precautions are essential due to potential toxicity or reactivity.
Formula:C14H13ClN4O
InChI:InChI=1S/C14H13ClN4O/c15-11-8-4-5-9-12(11)17-14(20)13(16)19-18-10-6-2-1-3-7-10/h1-9,18H,(H2,16,19)(H,17,20)
InChI key:InChIKey=VJBFVHRHRWXBRP-UHFFFAOYSA-N
SMILES:N(C(C(NNC1=CC=CC=C1)=N)=O)C2=C(Cl)C=CC=C2
Synonyms:- 2-Amino-N-(2-chlorophenyl)-2-(phenylhydrazinylidene)acetamide
- 2-[(2-Chlorophenyl)amino]-2-oxoethanimidic acid 2-phenylhydrazide
- 2-Amino-N-(2-chlorophenyl)-2-(2-phenylhydrazono)acetamide
- Ethanimidic acid, 2-[(2-chlorophenyl)amino]-2-oxo-, 2-phenylhydrazide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.