CAS 4752-58-3

4-(2-quinolin-2(1H)-ylideneethylidene)cyclohexa-2,5-dien-1-one

Description:

4-(2-quinolin-2(1H)-ylideneethylidene)cyclohexa-2,5-dien-1-one, with the CAS number 4752-58-3, is an organic compound characterized by its complex structure that includes a quinoline moiety and a cyclohexadienone framework. This compound typically exhibits properties associated with conjugated systems, such as enhanced stability and potential for electronic transitions, making it interesting for applications in organic electronics and photochemistry. The presence of the quinoline ring suggests potential biological activity, as many quinoline derivatives are known for their pharmacological properties. Additionally, the compound may display distinct colorimetric properties due to its conjugated double bonds, which can absorb light in specific regions of the electromagnetic spectrum. Its reactivity may be influenced by the electron-rich nature of the cyclohexadienone structure, allowing for various chemical transformations. Overall, this compound represents a fascinating intersection of organic chemistry and potential applications in medicinal chemistry and materials science.

Formula: C₁₇H₁₃NO

InChI: InChI=1/C17H13NO/c19-16-11-6-13(7-12-16)5-9-15-10-8-14-3-1-2-4-17(14)18-15/h1-12,18H

SMILES: c1ccc2c(c1)ccc(=CC=C1C=CC(=O)C=C1)[nH]2