
CAS 475203-81-7
:(2-Bromo-1,1-difluoroethyl)cyclohexane
Description:
(2-Bromo-1,1-difluoroethyl)cyclohexane is an organic compound characterized by its unique structure, which includes a cyclohexane ring substituted with a bromo and difluoroethyl group. This compound features a cyclohexane backbone, known for its stable, saturated structure, which contributes to its overall chemical stability. The presence of the bromine and fluorine atoms introduces notable reactivity, particularly in nucleophilic substitution reactions, due to the electronegative nature of these halogens. The difluoroethyl group enhances the compound's lipophilicity and may influence its solubility in organic solvents. Additionally, the steric effects of the bulky cyclohexane ring can impact the compound's reactivity and interaction with other molecules. As a halogenated compound, it may also exhibit specific properties such as increased density and potential applications in pharmaceuticals or agrochemicals. Safety considerations should be taken into account due to the presence of halogens, which can pose environmental and health risks. Overall, (2-Bromo-1,1-difluoroethyl)cyclohexane is a compound of interest in synthetic organic chemistry and materials science.
Formula:C8H13BrF2
InChI:InChI=1S/C8H13BrF2/c9-6-8(10,11)7-4-2-1-3-5-7/h7H,1-6H2
InChI key:InChIKey=IKZYGXYACJOUKS-UHFFFAOYSA-N
SMILES:C(CBr)(F)(F)C1CCCCC1
Synonyms:- Cyclohexane, (2-bromo-1,1-difluoroethyl)-
- (2-Bromo-1,1-difluoroethyl)cyclohexane
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.