CAS 475213-03-7
:(chloro-ethyl-methyl-silyl)methyl-methyl-dioctyl-silane
Description:
The chemical substance known as (chloro-ethyl-methyl-silyl)methyl-methyl-dioctyl-silane, with the CAS number 475213-03-7, is a silane compound characterized by its complex structure that includes both silane and organic functional groups. This compound typically exhibits properties such as hydrophobicity due to the presence of long hydrocarbon chains (dioctyl groups), which enhance its compatibility with organic materials. The chlorinated and ethyl-methyl-silyl groups contribute to its reactivity, allowing it to participate in various chemical reactions, including cross-linking and surface modification. Silanes like this one are often used in applications such as adhesion promoters, surface treatments, and as coupling agents in composites. The presence of multiple functional groups allows for versatility in modifying surfaces and enhancing the properties of materials, making it valuable in industries such as coatings, plastics, and electronics. Safety data sheets should be consulted for handling and storage guidelines, as silanes can be sensitive to moisture and may require specific precautions.
Formula:C21H47ClSi2
InChI:InChI=1/C21H47ClSi2/c1-6-9-11-13-15-17-19-23(4,21-24(5,22)8-3)20-18-16-14-12-10-7-2/h6-21H2,1-5H3
SMILES:CCCCCCCC[Si](C)(CCCCCCCC)C[Si](C)(CC)Cl
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.