CymitQuimica logo

CAS 475215-28-2

:

5-(2-Propen-1-yl)quinoline

Description:
5-(2-Propen-1-yl)quinoline, identified by its CAS number 475215-28-2, is an organic compound that features a quinoline core substituted with a propenyl group at the 5-position. Quinoline itself is a bicyclic aromatic compound known for its nitrogen-containing heterocyclic structure, which contributes to its diverse chemical reactivity and biological activity. The presence of the propenyl group introduces unsaturation, making the compound potentially reactive in various chemical reactions, such as electrophilic addition or polymerization. This compound may exhibit interesting properties, including fluorescence or photochemical behavior, due to its aromatic nature. Additionally, derivatives of quinoline are often studied for their pharmacological properties, including antimicrobial and anticancer activities. The specific characteristics, such as solubility, melting point, and stability, would depend on the molecular interactions and the environment in which the compound is placed. Overall, 5-(2-Propen-1-yl)quinoline represents a unique structure that could be of interest in both synthetic chemistry and medicinal research.
Formula:C12H11N
InChI:InChI=1S/C12H11N/c1-2-5-10-6-3-8-12-11(10)7-4-9-13-12/h2-4,6-9H,1,5H2
InChI key:InChIKey=BHJDPQOAJYAFLK-UHFFFAOYSA-N
SMILES:C(C=C)C=1C2=C(C=CC1)N=CC=C2
Synonyms:
  • 5-(2-Propen-1-yl)quinoline
  • Quinoline, 5-(2-propen-1-yl)-
  • Quinoline, 5-(2-propenyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.