CymitQuimica logo

CAS 475250-52-3

:

4-Methoxybenzylboronic acid pinacol ester

Description:
4-Methoxybenzylboronic acid pinacol ester is an organoboron compound characterized by the presence of a boronic acid functional group and a methoxy-substituted aromatic ring. This compound typically appears as a white to off-white solid and is soluble in organic solvents such as dichloromethane and tetrahydrofuran. The boronic acid moiety allows for participation in various chemical reactions, particularly in Suzuki-Miyaura cross-coupling reactions, making it valuable in organic synthesis and medicinal chemistry. The methoxy group enhances the electron density of the aromatic ring, influencing its reactivity and stability. Additionally, the pinacol ester formation provides increased stability to the boronic acid, facilitating its handling and storage. This compound is often used in the development of pharmaceuticals and agrochemicals, as well as in materials science for the synthesis of boron-containing polymers. Safety data should be consulted for handling and disposal, as with all chemical substances, to ensure proper laboratory practices.
Formula:C14H23BO4
InChI:InChI=1/C14H23BO4/c1-13(2,16)14(3,4)19-15(17)10-11-6-8-12(18-5)9-7-11/h6-9,16-17H,10H2,1-5H3
InChI key:HPNLRRQVSZVKHY-UHFFFAOYSA-N
SMILES:CC(C)(C(C)(C)OB(Cc1ccc(cc1)OC)O)O
Synonyms:
  • 2-(4-Methoxybenzyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane
Found 6 products.