CAS 4753-03-1
:2'-deoxy-2'-iodouridine
Description:
2'-Deoxy-2'-iodouridine is a nucleoside analog characterized by the presence of an iodine atom at the 2' position of the ribose sugar. This modification can influence its biological activity and stability. The compound consists of a deoxyribose sugar linked to a uracil base, which is a pyrimidine derivative. The iodine substitution can enhance the compound's antiviral properties, making it of interest in medicinal chemistry, particularly in the development of antiviral agents. Its structure allows it to participate in nucleic acid synthesis, potentially interfering with viral replication processes. The CAS number 4753-03-1 uniquely identifies this compound in chemical databases, facilitating research and regulatory processes. As a nucleoside analog, 2'-deoxy-2'-iodouridine may exhibit unique pharmacokinetic and pharmacodynamic properties, which are crucial for its application in therapeutic contexts. Overall, its iodine substitution and nucleoside structure contribute to its potential utility in various biochemical and pharmaceutical applications.
Formula:C9H11IN2O5
InChI:InChI=1/C9H11IN2O5/c10-6-7(15)4(3-13)17-8(6)12-2-1-5(14)11-9(12)16/h1-2,4,6-8,13,15H,3H2,(H,11,14,16)/t4-,6-,7-,8-/m1/s1
SMILES:c1cn([C@H]2[C@@H]([C@@H]([C@@H](CO)O2)O)I)c(=O)nc1O
Synonyms:- 2'-iodo-2'-deoxyuridine
- ’-Deoxy-2’-iodouridine
- 2’-Deoxy-2’-iodouridine, 2’-Iodo-2’-deoxyuridine
- 2'-Deoxy-2'-iodouridine
- See more synonyms
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
2'-Deoxy-2'-iodouridine
CAS:2'-Deoxy-2'-iodouridine is a Halo-nucleoside.Formula:C9H11IN2O5Color and Shape:SolidMolecular weight:354.1
