CymitQuimica logo

CAS 475437-27-5

:

Spiro[furo[3,4-c]pyridine-1(3H),4′-piperidine]

Description:
Spiro[furo[3,4-c]pyridine-1(3H),4′-piperidine] is a complex organic compound characterized by its unique spirocyclic structure, which features a fused pyridine and piperidine moiety. This compound typically exhibits a bicyclic framework, where the furo[3,4-c]pyridine ring system is connected to a piperidine ring through a spiro carbon atom. The presence of nitrogen atoms in both the pyridine and piperidine rings contributes to its potential basicity and reactivity, making it of interest in medicinal chemistry and drug design. The compound may display various biological activities, which can be attributed to its structural features that allow for interactions with biological targets. Additionally, its solubility and stability can vary based on the functional groups present and the overall molecular conformation. As with many heterocyclic compounds, the synthesis and characterization of Spiro[furo[3,4-c]pyridine-1(3H),4′-piperidine] are crucial for understanding its potential applications in pharmaceuticals and materials science.
Formula:C11H14N2O
InChI:InChI=1S/C11H14N2O/c1-4-13-7-9-8-14-11(10(1)9)2-5-12-6-3-11/h1,4,7,12H,2-3,5-6,8H2
InChI key:InChIKey=PSPZNNARAQMDDW-UHFFFAOYSA-N
SMILES:C12(C=3C(CO1)=CN=CC3)CCNCC2
Synonyms:
  • Spiro[furo[3,4-c]pyridine-1(3H),4′-piperidine]
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.