CAS 475481-97-1
:4-(Chloromethyl)-2-(3-chlorophenyl)-5-methyloxazole
Description:
4-(Chloromethyl)-2-(3-chlorophenyl)-5-methyloxazole, with the CAS number 475481-97-1, is a chemical compound characterized by its oxazole ring structure, which is a five-membered heterocyclic compound containing both nitrogen and oxygen. This substance features a chloromethyl group and a chlorophenyl substituent, contributing to its reactivity and potential applications in organic synthesis and medicinal chemistry. The presence of chlorine atoms enhances its electrophilic properties, making it useful in various chemical reactions, including nucleophilic substitutions. The methyl group on the oxazole ring can influence its solubility and stability. This compound may exhibit biological activity, making it of interest in pharmaceutical research. Its specific physical and chemical properties, such as melting point, boiling point, and solubility, would typically be determined through experimental methods. As with many chlorinated compounds, it is essential to handle it with care due to potential toxicity and environmental concerns. Proper safety protocols should be followed when working with this substance in a laboratory setting.
Formula:C11H9Cl2NO
InChI:InChI=1S/C11H9Cl2NO/c1-7-10(6-12)14-11(15-7)8-3-2-4-9(13)5-8/h2-5H,6H2,1H3
InChI key:InChIKey=IAKHDTQJFDTTSR-UHFFFAOYSA-N
SMILES:C(Cl)C=1N=C(OC1C)C2=CC(Cl)=CC=C2
Synonyms:- Oxazole, 4-(chloromethyl)-2-(3-chlorophenyl)-5-methyl-
- 4-Chloromethyl-2-(3-chlorophenyl)-5-methyloxazole
- 4-Chloromethyl-5-methyl-2-(3-chlorophenyl)oxazole
- 4-(Chloromethyl)-2-(3-chlorophenyl)-5-methyloxazole
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.