CAS 4759-22-2

2,6-Dihydroxy-4-methoxybenzoic acid

Description:

2,6-Dihydroxy-4-methoxybenzoic acid, with the CAS number 4759-22-2, is an organic compound belonging to the class of benzoic acids. It features a benzene ring substituted with two hydroxyl groups at the 2 and 6 positions and a methoxy group at the 4 position. This compound is typically characterized by its white to off-white crystalline appearance and is soluble in polar solvents due to the presence of hydroxyl groups, which can engage in hydrogen bonding. The presence of both hydroxyl and methoxy groups contributes to its potential antioxidant properties and biological activity. It may be used in various applications, including pharmaceuticals, cosmetics, and as a chemical intermediate in organic synthesis. The compound's acidity is influenced by the carboxylic acid functional group, making it a weak acid. Additionally, its structural features may allow for various chemical reactions, such as esterification or etherification, further expanding its utility in chemical synthesis.

Formula: C₈H₈O₅

InChI: InChI=1S/C8H8O5/c1-13-4-2-5(9)7(8(11)12)6(10)3-4/h2-3,9-10H,1H3,(H,11,12)

InChI key: InChIKey=FMWLFUMFGLGSCD-UHFFFAOYSA-N

SMILES: C(O)(=O)C1=C(O)C=C(OC)C=C1O

Synonyms:

• 2,6-Dihydroxy-4-methoxybenzoic acid
• Benzoic acid, 2,6-dihydroxy-4-methoxy-
• γ-Resorcylic acid, 4-methoxy-