CymitQuimica logo

CAS 4759-64-2

:

4-(1,3-Benzodioxol-5-yl)dihydro-2H-pyran-2,6(3H)-dione

Description:
4-(1,3-Benzodioxol-5-yl)dihydro-2H-pyran-2,6(3H)-dione, also known by its CAS number 4759-64-2, is a chemical compound characterized by its unique bicyclic structure that incorporates both a benzodioxole moiety and a dihydropyran-2,6-dione framework. This compound typically exhibits properties such as being a solid at room temperature, with potential solubility in organic solvents. Its structure suggests the presence of multiple functional groups, which may contribute to its reactivity and potential biological activity. The benzodioxole ring is known for its role in various pharmacological activities, while the dihydropyran-2,6-dione component may impart additional chemical properties. This compound may be of interest in medicinal chemistry and organic synthesis due to its potential applications in drug development or as an intermediate in the synthesis of more complex molecules. However, specific physical and chemical properties such as melting point, boiling point, and spectral data would require empirical measurement or literature reference for precise characterization.
Formula:C12H10O5
InChI:InChI=1S/C12H10O5/c13-11-4-8(5-12(14)17-11)7-1-2-9-10(3-7)16-6-15-9/h1-3,8H,4-6H2
InChI key:InChIKey=JCFALDFNONMKLM-UHFFFAOYSA-N
SMILES:O=C1CC(CC(=O)O1)C=2C=C3C(=CC2)OCO3
Synonyms:
  • 2H-Pyran-2,6(3H)-dione, 4-(1,3-benzodioxol-5-yl)dihydro-
  • Glutaric anhydride, 3-[3,4-(methylenedioxy)phenyl]-
  • 3-Benzo[1,3]dioxol-5-yl-pentanedioic acid anhydride
  • 4-(1,3-Benzodioxol-5-yl)dihydro-2H-pyran-2,6(3H)-dione
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.